![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 17-Zoology.pdf | 2015-06-10 01:21 | 34K | |
| 11-Geology.pdf | 2015-06-10 01:21 | 35K | |
| 10-Forestry.pdf | 2015-06-10 01:21 | 35K | |
| 4-Agriculture.pdf | 2015-06-10 01:29 | 36K | |
| 5-Botany.pdf | 2015-06-10 01:29 | 37K | |
| Indian Penal Code Etc.,- Paper-2.pdf | 2015-06-10 01:36 | 38K | |
| Assistant Public Prosecutor, Gr-A-paper_2.pdf | 2015-06-10 01:32 | 41K | |
| Assistant Public Prosecuto, Gr-Ar- paper_1.pdf | 2015-06-10 01:32 | 44K | |
| 6-Botany.pdf | 2015-06-10 01:29 | 44K | |
| 16-Zoology.pdf | 2015-06-10 01:21 | 44K | |
| 4-Agriculture_001.pdf | 2015-06-10 01:29 | 44K | |
| ZOOLOGY_OPT.pdf | 2015-06-10 01:48 | 44K | |
| 10-Geology.pdf | 2015-06-10 01:21 | 45K | |
| GEOLOGY_OPT.pdf | 2015-06-10 01:35 | 45K | |
| Assitant Public Procecutor, Gr-A-2007- Paper-2.pdf | 2015-06-10 01:33 | 46K | |
| Assistant-Public-Prosecutor-Gr-A-Paper-2.pdf | 2015-06-10 01:32 | 46K | |
| FORESTRY_OPT.pdf | 2015-06-10 01:35 | 47K | |
| 7-Chemical Engineering.pdf | 2015-06-10 01:29 | 47K | |
| BOTANY_OPT.pdf | 2015-06-10 01:33 | 47K | |
| Assitant Public Procecutor, Gr-A-2007- Paper-1.pdf | 2015-06-10 01:33 | 47K | |
| 9-Forestry.pdf | 2015-06-10 01:29 | 48K | |
| 8-Chemistry.pdf | 2015-06-10 01:29 | 48K | |
| 12-Horticulture.pdf | 2015-06-10 01:21 | 48K | |
| Assistant-Public-Prosecutor-Gr-A-Paper-1.pdf | 2015-06-10 01:32 | 48K | |
| 13-Mathematics.pdf | 2015-06-10 01:21 | 48K | |
| 11-Horticulture.pdf | 2015-06-10 01:21 | 49K | |
| Land_Revenue_Criminal_law_Paper_1_2012.pdf | 2015-06-10 01:37 | 49K | |
| Land_Revenue_Criminal_law_Paper_1_2011.pdf | 2015-06-10 01:37 | 50K | |
| Assistant Public Prosecutor, Gr-A,2010- Paper-1.pdf | 2015-06-10 01:32 | 51K | |
| 15-Physics.pdf | 2015-06-10 01:21 | 51K | |
| 14-Physics.pdf | 2015-06-10 01:21 | 52K | |
| Class1 and 2 Officers Printing And Stationery Dept. Departmental Examination October, 2012- Paper1.pdf | 2015-06-10 01:33 | 53K | |
| Land_Revenue_Criminal_law_Paper_1_2006.pdf | 2015-06-10 01:37 | 54K | |
| Civil Procedure Code Etc.- Paper-1.pdf | 2015-06-10 01:33 | 55K | |
| 13-Mechanical Engineering.pdf | 2015-06-10 01:21 | 57K | |
| 3-Agriculture Engineering.pdf | 2015-06-10 01:29 | 61K | |
| Maharashtra Civil Engineering Services Main Examination- 2009-Paper-II.pdf | 2015-06-10 01:38 | 61K | |
| 14-Mechanical Engineering.pdf | 2015-06-10 01:21 | 61K | |
| Maharashtra Engineering (Civil) Services Examination-2007- Civil Engineering- Paper-2.pdf | 2015-06-10 01:39 | 62K | |
| AGRI_OPT.pdf | 2015-06-10 01:29 | 62K | |
| 3-Agriculture Engineering_001.pdf | 2015-06-10 01:29 | 62K | |
| 5-Animal Husbandry and Veterinary Sciences.pdf | 2015-06-10 01:29 | 63K | |
| 9-Civil Engineering.pdf | 2015-06-10 01:29 | 63K | |
| ANIMAL_HUSBANDRY_VETERINARY_SCI_OPT.pdf | 2015-06-10 01:29 | 65K | |
| HORTICULTURE_OPT.pdf | 2015-06-10 01:36 | 66K | |
| PHYSICS_OPT.pdf | 2015-06-10 01:43 | 66K | |
| Assistant_Controller_of_Meterology_Gr-B.pdf | 2015-06-10 01:33 | 67K | |
| Maharashtra Civil Engineering Services Main Examination- 2009- Paper-III.pdf | 2015-06-10 01:38 | 68K | |
| 12-Mathematics.pdf | 2015-06-10 01:21 | 68K | |
| Maharashtra Engineering (Civil) Services Examination-2007- Civil Engineering- Paper-3.pdf | 2015-06-10 01:39 | 69K | |
| 6-Chemical Engineering.pdf | 2015-06-10 01:29 | 70K | |
| Land_Revenue_Criminal_law_Paper_1_2009.pdf | 2015-06-10 01:37 | 71K | |
| AGRI_ENGG_OPT.pdf | 2015-06-10 01:29 | 72K | |
| MATHEMATICS_OPT.pdf | 2015-06-10 01:42 | 72K | |
| Maharashtra Agriculture Services Main Examination- 2011.pdf | 2015-06-10 01:38 | 73K | |
| CHEM_ENGG_OPT.pdf | 2015-06-10 01:33 | 73K | |
| 7-Chemistry.pdf | 2015-06-10 01:29 | 73K | |
| CHEMISTRY_OPT.pdf | 2015-06-10 01:33 | 73K | |
| 16-Statistics.pdf | 2015-06-10 01:21 | 75K | |
| 8-Civil Engineering.pdf | 2015-06-10 01:29 | 75K | |
| 15-Statistics.pdf | 2015-06-10 01:21 | 76K | |
| Bombay_Forest_Manual_Vol_1_2_3_Paper_3_2006.pdf | 2015-06-10 01:33 | 76K | |
| METRON_GRADE_3 SCREENING TEST-2011.pdf | 2015-06-10 01:42 | 77K | |
| 2-English.pdf | 2015-06-10 01:21 | 79K | |
| ENGLISH.pdf | 2015-06-10 01:35 | 82K | |
| Joint, Deputy and Assistant Charity Commissioner Examination- 2009.pdf | 2015-06-10 01:37 | 85K | |
| Ind_Forest_Act_XVI_1927_Paper_2_2006.pdf | 2015-06-10 01:36 | 85K | |
| Maharashtra Civil Engineering Services Main Examination- 2009- Paper-I.pdf | 2015-06-10 01:38 | 89K | |
| Forest_Law_Ind_Forest_Act_Paper_2_2012.pdf | 2015-06-10 01:35 | 90K | |
| Procedure_&_Account_Paper_3_2011.pdf | 2015-06-10 01:44 | 94K | |
| Maharashtra Engineering (Civil) Services Examination-2007- Civil Engineering- Paper-1.pdf | 2015-06-10 01:39 | 95K | |
| STATISTICS_OPT.pdf | 2015-06-10 01:47 | 95K | |
| MECH_ENGG_OPT.pdf | 2015-06-10 01:42 | 96K | |
| Civil Judge [Jr. Division] and Judicial Magistrate [First Class] Main Examination- 2012 [ PAPER-1].pdf | 2015-06-10 01:33 | 98K | |
| Class1 and 2 Officers Printing And Stationery Dept. Departmental Examination October, 2012- Paper2.pdf | 2015-06-10 01:33 | 99K | |
| Procedure_&_Account_Paper_3_2012.pdf | 2015-06-10 01:44 | 99K | |
| ENGLISH_001.pdf | 2015-06-10 01:35 | 99K | |
| 1-Marathi.pdf | 2015-06-10 01:21 | 102K | |
| Procedure_&_Account_Paper_3_2009.pdf | 2015-06-10 01:44 | 104K | |
| CIVIL_ENGG_OPT.pdf | 2015-06-10 01:33 | 105K | |
| Civil Judge [Jr. Division] and Judicial Magistrate [First Class] Main Examination- 2012- PAPER- 2.pdf | 2015-06-10 01:33 | 107K | |
| Forest_Law_Ind_Forest_Act_Paper_2_2011.pdf | 2015-06-10 01:35 | 107K | |
| Assistant Controllers Legal Metrology Group-B Departmental Examination- October-2012.pdf | 2015-06-10 01:30 | 114K | |
| 2-English_001.pdf | 2015-06-10 01:21 | 114K | |
| Maharashtra Engineering Civil Services Main Examination- 2011 [Paper-1].pdf | 2015-06-10 01:39 | 115K | |
| Forest_Law_Ind_Forest_Act_Paper_2_2009.pdf | 2015-06-10 01:35 | 115K | |
| Departmental Examination for the Police Officers [Lower Standard]-June-2013.pdf | 2015-06-10 01:34 | 143K | |
| Maharashtra Development Services Class- I And II Departmental Examination- October-2012.pdf | 2015-06-10 01:38 | 145K | |
| 20140606054813PM_State Service Main Examination-2014 - English.pdf | 2015-06-10 01:28 | 146K | |
| 1-Marathi_001.pdf | 2015-06-10 01:21 | 146K | |
| Assistant Limited Departmental Examination- 2009- Paper-2.pdf | 2015-06-10 01:31 | 149K | |
| 20131030034521PM_State Services Main Examination-2013-MARATHI.pdf | 2015-06-10 01:23 | 150K | |
| Maharashtra Engineering Civil Services Main Examination- 2011 [Paper-2].pdf | 2015-06-10 01:39 | 151K | |
| -MAHARASHTRA AFRICULTURAL SERVICES MAIN EXAMINATION-2011-AGRICULTURE_SCIENCE.pdf | 2015-06-10 01:20 | 151K | |
| Land Records Qualiftying Departmental Examination-2012.pdf | 2015-06-10 01:37 | 151K | |
| Assistant Limited Departmental Examination- 2007- Paper-2.pdf | 2015-06-10 01:31 | 151K | |
| 20131030034114PM_State Services Main Examination-2013- ENGLISH.pdf | 2015-06-10 01:23 | 157K | |
| Assistant Commissioner (Ward Officer) Screening Test - 2008- Paper-2.pdf | 2015-06-10 01:30 | 157K | |
| 20140606054923PM_State Service Main Examination-2014 - Marathi.pdf | 2015-06-10 01:28 | 161K | |
| Directorate of Mumbai Class- I And II Departmental Examination- October-2012.pdf | 2015-06-10 01:35 | 174K | |
| Departmental exam for the Officer of Co Operative Department- June-2013.pdf | 2015-06-10 01:34 | 174K | |
| Maharashtra Engineering Civil Services Main Examination- 2011 [Paper-3].pdf | 2015-06-10 01:39 | 174K | |
| MAHARASHTRA CIVIL ENGINEERING SERVICES PRELIMINARY EXAM_2011.pdf | 2015-06-10 01:38 | 178K | |
| MARATHI.pdf | 2015-06-10 01:41 | 179K | |
| MARATHI_001.pdf | 2015-06-10 01:41 | 185K | |
| Supernumerary Assistant Collectors, Probationary Deputy Collectors And Probationary Tahsildars, Probationary Naib Tahsil.pdf | 2015-06-10 01:48 | 195K | |
| Civil Judge Junior Division and Judicial Magistrate First Class Preliminary Examination-2012 -QP.pdf | 2015-06-10 01:33 | 202K | |
| Assistant Limited Departmental Examination- 2007-Paper-1.pdf | 2015-06-10 01:31 | 204K | |
| Animal Husbandry Dept Exam-June-2013.pdf | 2015-06-10 01:29 | 207K | |
| Pharmacist, Gr-B Screening Test-2012.pdf | 2015-06-10 01:43 | 211K | |
| Assistant Limited Departmental Examination- 2009- Paper-1.pdf | 2015-06-10 01:31 | 220K | |
| Deaprtmental Exam for Assistant Inspector of Motor Vehicle Department-June-2013.pdf | 2015-06-10 01:33 | 228K | |
| 20140128021259PM_Maharashtra Engineering [Civil] Services Main Examination-2013- Civil Engineering-Paper_2.pdf | 2015-06-10 01:24 | 233K | |
| Assistant Geologist Gr B Junior Geologist Group-B Combined Screening Test 2013.pdf | 2015-06-10 01:30 | 233K | |
| 20140128021316PM_Maharashtra Engineering [Civil] Services Main Examination-2013- Civil Engineering-Paper_1.pdf | 2015-06-10 01:24 | 238K | |
| Maharashtra Agricultural Services Examination- 2007- AGRICULTURE SCIENCE.pdf | 2015-06-10 01:38 | 243K | |
| CIVIL JUDGES(JUNIOR DIVISION)JUDICIAL MAGISTRATE (FIRST CLASS) COMPETITIVE (MAIN) EXAMINATION - 2011 (PAPER 1 & 2).pdf | 2015-06-10 01:33 | 244K | |
| 20140109034600PM_Officers_of_the_Printing_and_Stationary_Department.pdf | 2015-06-10 01:24 | 246K | |
| MAHARASHTRA AFRICULTURAL SERVICES MAIN EXAMINATION-2011-AGRICULTURE_ENGINEERING.pdf | 2015-06-10 01:37 | 257K | |
| MAHARASHTRA AFRICULTURAL SERVICES MAIN EXAMINATION-2011-AGRICULTURE.pdf | 2015-06-10 01:37 | 259K | |
| LECTURER IN BOTANY Screenig Test 2011.pdf | 2015-06-10 01:37 | 260K | |
| Departmetnal Examination of Police Officer [Higher Standard] of Police Service-June-2013.pdf | 2015-06-10 01:34 | 261K | |
| LECTURER IN COMMERCE Screenig Test 2011.pdf | 2015-06-10 01:37 | 275K | |
| 20140128021239PM_Maharashtra Engineering [Civil] Services Main Examination-2013- Civil Engineering-Paper_3.pdf | 2015-06-10 01:24 | 275K | |
| LECTURER IN ZOOLOGY Screenig Test 2011.pdf | 2015-06-10 01:37 | 278K | |
| LECTURER IN ENGLISH Screenig Test 2011.pdf | 2015-06-10 01:37 | 283K | |
| Assistant Town Planner, Gr-B Online Examination- 2013.pdf | 2015-06-10 01:32 | 295K | |
| QP_Dy. Eng(Mech.).pdf | 2015-06-10 01:45 | 302K | |
| Deputy Engineer [Electrical and Mechanical], Maharashtra Enginering Services, Gr-A Screening Test- 2012.pdf | 2015-06-10 01:34 | 314K | |
| Maharashtra Development Services Dept Exam- Oct.2007.pdf | 2015-06-10 01:38 | 316K | |
| Finance And Accounts Services Class- I Departmental Examination- October-2012.pdf | 2015-06-10 01:35 | 320K | |
| LECTURER IN CHEMISTRY Screenig Test 2011.pdf | 2015-06-10 01:37 | 321K | |
| Maharashtra Educational Service Class-I and Class-III Departmental Exam-June-2013.pdf | 2015-06-10 01:39 | 329K | |
| Clerk-Typist-(Marathi-and-English)-Examination-2011.pdf | 2015-06-10 01:33 | 330K | |
| Forest Officer Departmental Exam-June-2013.pdf | 2015-06-10 01:35 | 342K | |
| Maharashtra Agricultural Services Examination- 2007- AGRICUTURE.pdf | 2015-06-10 01:38 | 350K | |
| Stenographer & Stenotypist (Higher & Lower Grade) (English), Gr-B Screening Test-2012.pdf | 2015-06-10 01:47 | 356K | |
| Maharashtra Development Services Dept Exam- Oct-2012.pdf | 2015-06-10 01:38 | 356K | |
| Departmental Examination for the Officer of the Jail Department-June-2013.pdf | 2015-06-10 01:34 | 366K | |
| Maharashtra Development Services Dept Exam-Oct- 2007.pdf | 2015-06-10 01:38 | 374K | |
| Agricultural Officer Dept Exam-June-2013.pdf | 2015-06-10 01:29 | 375K | |
| Drug Inspector,GSS, Gr-B Screening Test-2008.pdf | 2015-06-10 01:35 | 378K | |
| Directorare of Arts Dept Exam- July-2003.pdf | 2015-06-10 01:34 | 379K | |
| Deaprtmental Examination for the Officers of the Indian Police Service-June-2013.pdf | 2015-06-10 01:34 | 388K | |
| 20140109102235AM_Land Record Qualifying Departmental Examination (Paper 1 to 6 ).pdf | 2015-06-10 01:24 | 391K | |
| 20140718124333PM_Lecturer in Civil Enginnering, Govt. Polytechnic, Gr-B Screening Test-2014.pdf | 2015-06-10 01:29 | 391K | |
| Maharashtra Engineering [Civil] Services Main Examination- 2011 [ Marathi, English & General Studies].pdf | 2015-06-10 01:39 | 394K | |
| Police Sub Inspector Preliminery Examination- 2012.pdf | 2015-06-10 01:44 | 405K | |
| 20140405114900AM_Lecturer_Maths_Gr_B_2014.pdf | 2015-06-10 01:26 | 408K | |
| Sales Tax Inspector Main 2011- PAPER 1.pdf | 2015-06-10 01:46 | 409K | |
| Special Auditor, Maharashtra Co-Operative Services, Group A- 2011.pdf | 2015-06-10 01:47 | 418K | |
| 001.pdf | 2015-06-10 01:20 | 418K | |
| 20140311122652PM_LECTURER, MEDICAL ELECTRONICS, GR-A, Govt. ITI, Screening Test- 2013.pdf | 2015-06-10 01:25 | 420K | |
| Deaprtmental Exam for Qualifying for Promotion to the post of A.R.T. Officer-June-2013.pdf | 2015-06-10 01:33 | 426K | |
| Police Sub Inspector Main Examination 2011 (Paper-1).pdf | 2015-06-10 01:43 | 430K | |
| 20140423050928PM_Lecturer in Computer Engineering, Govt. Polytechnic, Gr-A Screening Test-2013.pdf | 2015-06-10 01:27 | 436K | |
| 20140423050950PM_Lecturer in Automobile Engineering, Govt. Polytechnic, gr-A Screening Test-2013.pdf | 2015-06-10 01:27 | 440K | |
| Sales Tax Inspector Preliminary Examination 2011.pdf | 2015-06-10 01:46 | 443K | |
| 20140416113649PM_Lecturer_Mech_Engineering_2014.pdf | 2015-06-10 01:27 | 444K | |
| 20140429044226PM_LECTURER, ELECTRICAL ENGG, GR-A SCREENING TEST-2013.pdf | 2015-06-10 01:27 | 444K | |
| 20140311122543PM_LECTURER, PHYSICS, GR-A, Govt. ITI, Screening Test-2013.pdf | 2015-06-10 01:25 | 447K | |
| 20140109023538PM_Supernumerary Assistant Collectors, Probationary Deputy Collectors and Probationary Tahsildars, Nayab Tahsildars .pdf | 2015-06-10 01:24 | 448K | |
| Maharashtra Development Services Dept Exam-April-2005.pdf | 2015-06-10 01:38 | 450K | |
| 20131217101618AM_Police Sub Inspector Main Exam-2013- Paper-1- Marathi and English.pdf | 2015-06-10 01:24 | 452K | |
| Assistant_Chemical_Analyser,Gr-B_Screening_Test.pdf | 2015-06-10 01:33 | 452K | |
| 20140109102504AM_Maharashtra Development Services Class I and Class II.pdf | 2015-06-10 01:24 | 453K | |
| Maharashtra Agricultural Services Examination- 2007- AGRICUTURE ENGINEERING.pdf | 2015-06-10 01:38 | 454K | |
| Assistant-Main-Examination-2011-Paper-1-Marathi-and-English.pdf | 2015-06-10 01:32 | 458K | |
| 20140610051548PM_Civil Judge Preliminary Examination-2014.pdf | 2015-06-10 01:28 | 458K | |
| Directorate of Geology and Mining Exam-Oct-2004.pdf | 2015-06-10 01:35 | 459K | |
| Assistant Motor Vehicle Inspector Preliminary Competitive Examination- 2011.pdf | 2015-06-10 01:32 | 460K | |
| Assistant Regional Transpost Officer Departmental Examination-June-2013.pdf | 2015-06-10 01:32 | 461K | |
| Sales Tax Inspector Preliminery Examination- 2012.pdf | 2015-06-10 01:46 | 466K | |
| 20140526044114PM_Lecturer in Chemistry, Govt. Polytechnic, Gr-A Screening Test-2013.pdf | 2015-06-10 01:28 | 467K | |
| Assistant Collectors, Deputy Collectors and Prabationery Tahsildars Dept Exam- May-2011.pdf | 2015-06-10 01:30 | 471K | |
| 20140311122739PM_LECTURER, FOOD TECHNOLOGY, GR-A, Govt. ITI, Screening Test- 2013.pdf | 2015-06-10 01:25 | 479K | |
| Police Sub Inspector Limited Departmental Preliminery Examination- 2009.pdf | 2015-06-10 01:43 | 481K | |
| Assistant Limited Departmental Examination- 2011 (Paper- 1).pdf | 2015-06-10 01:31 | 481K | |
| Social Welfare Officer Screening Test- 2009.pdf | 2015-06-10 01:47 | 484K | |
| Assistant Commissioner (Ward Officer), Gr-A in MCGM.pdf | 2015-06-10 01:30 | 487K | |
| Stenographer & Stenotypist (Higher & Lower Grade) (Marathi), Gr-B Screening Test-2012.pdf | 2015-06-10 01:48 | 488K | |
| Assistant Collectors, Deputy Collectors and Prabationery Tahsildars Dept Exam- Jan-2011.pdf | 2015-06-10 01:30 | 508K | |
| Assistant Collectors, Deputy Collectors and Prabationery Tahsildars Dept Exam-Oct-2012.pdf | 2015-06-10 01:30 | 511K | |
| Police Sub Inspector Main Examination 2011 (Paper-2).pdf | 2015-06-10 01:43 | 518K | |
| 20140421070914PM_LECTURER, ELECTRONICS, GOVT. POLYTECHNIC, GR-A SCREENING TEST-2013.pdf | 2015-06-10 01:27 | 522K | |
| 20131021043112PM_Maharashtra Engineering [Civil] Services Preliminary Examination-2013.pdf | 2015-06-10 01:22 | 526K | |
| Industries Officer, Gr-B Screening Test- 2012.pdf | 2015-06-10 01:36 | 527K | |
| Sales Tax Inspector Main Examination- 2011 [Paper-1-MAR and ENG].pdf | 2015-06-10 01:45 | 533K | |
| Departmental Exam for the Promotion of Superintendent of Prohibition and Excise Department-June-2013.pdf | 2015-06-10 01:34 | 541K | |
| Maharashtra Agricultural Services Examination- 2007- MARATHI, ENGLISH and GENERAL STUDIES.pdf | 2015-06-10 01:38 | 544K | |
| Assistant Motor Vehicle Inspector Main Examination- 2011.pdf | 2015-06-10 01:32 | 554K | |
| Ground Water Survey and Development Exam-Nov-2008.pdf | 2015-06-10 01:36 | 555K | |
| COMMEN_SCREENING_TEST-2011.pdf | 2015-06-10 01:33 | 555K | |
| 20140503043150PM_Assistant Regional Transport Officer Departmental Examination -January- 2011.pdf | 2015-06-10 01:27 | 560K | |
| 20140708072635PM_Child Development Project Officer Screening Test-2014.pdf | 2015-06-10 01:29 | 567K | |
| Assistant Preliminery Examination-20112011.pdf | 2015-06-10 01:32 | 577K | |
| Sales-Tax-Inspector-Ltd-Dept2011-Paper-1.pdf | 2015-06-10 01:46 | 578K | |
| Assistant Commissioner [Drugs], Gr-A Screening Test- 2012.pdf | 2015-06-10 01:30 | 582K | |
| Sales Tax Inspector Preliminery Examination- 2011.pdf | 2015-06-10 01:46 | 583K | |
| 001_001.pdf | 2015-06-10 01:21 | 594K | |
| Assistant Director Town Planning, Gr-A Online Examination- 2013.pdf | 2015-06-10 01:30 | 597K | |
| Assistant-Main-Examination-2011-Paper-2-G.K._and_I.T.pdf | 2015-06-10 01:32 | 599K | |
| Police Sub Inspector Limited Departmental Preliminery Examination- 2011.pdf | 2015-06-10 01:43 | 600K | |
| 20140607072515PM_Sales Tax Inspector Main Examination-2014- Paper-1- Marathi and English.pdf | 2015-06-10 01:28 | 602K | |
| 20140220050456PM_Assistant Main Examination-2013-Paper-1.pdf | 2015-06-10 01:25 | 605K | |
| Maharashtra Agriculural Services Main Examination- 2012- Agriculture Science.pdf | 2015-06-10 01:38 | 608K | |
| 20140405114822AM_Deputy Education Officer Screening Test-2014.pdf | 2015-06-10 01:26 | 608K | |
| 20131217102459AM_Statastical and Research Officer Screening Test-2011.pdf | 2015-06-10 01:24 | 609K | |
| Social Welfare Officer Gr-B Screening Test-2012.pdf | 2015-06-10 01:46 | 614K | |
| 20140328031259PM_Asst.Legal Adviser cum Under Secretary Gr-A -Online Exam.dt.15.03.2014.pdf | 2015-06-10 01:26 | 618K | |
| Assistant Preliminery Examination-2012.pdf | 2015-06-10 01:32 | 618K | |
| Marathi and English- Paper I.pdf | 2015-06-10 01:41 | 622K | |
| Special District Social Welfare Officer,Gr-A.pdf | 2015-06-10 01:47 | 625K | |
| Sales Tax Inspector Main 2011 PAPER 2.pdf | 2015-06-10 01:45 | 636K | |
| Maharashtra Forest Services Examination-2008 - General Studies and Mathematics.pdf | 2015-06-10 01:41 | 643K | |
| QP - Maharashtra Forest Services Preliminery Examination-2012.pdf | 2015-06-10 01:45 | 650K | |
| Assistant Limited Departmental Examination- 2012-Paper 1.pdf | 2015-06-10 01:31 | 654K | |
| Assistant_Engineer_(Electrical)_Grade-2_Maharashtra_Engineering_Services_Gr-B.pdf | 2015-06-10 01:33 | 658K | |
| Directorate of Arts Exam-January-2013.pdf | 2015-06-10 01:34 | 663K | |
| District Women and Child Development Officer Gr A and Inspector Certified Schools and Equivalent Posts Group B Common Screening Test 2012.pdf | 2015-06-10 01:35 | 691K | |
| Maharashtra Engineering (Civil) Services Examination 2013- Paper 2.pdf | 2015-06-10 01:39 | 694K | |
| 20131217101441AM_Assistant Motor Vehicle Inspector Main Exam-2013.pdf | 2015-06-10 01:24 | 698K | |
| Maharashtra Forest Services Examination-2007 - General Studies and Mathematics.pdf | 2015-06-10 01:41 | 699K | |
| 20140225111823AM_Lecturer in English, Govt. Polytechnic, Gr-A Screening Test-2014.pdf | 2015-06-10 01:25 | 700K | |
| Inspector_Certified_School_&_Institution_G.S.S._GR-B.pdf | 2015-06-10 01:37 | 702K | |
| Clerk Typist Examination-2013.pdf | 2015-06-10 01:33 | 704K | |
| 20140225112531AM_Assistant Limited Departmental Examination-2013- Paper-1.pdf | 2015-06-10 01:25 | 704K | |
| State Services Preliminery Examination-2009.pdf | 2015-06-10 01:47 | 706K | |
| Ground Water Survey and Development Exam-Jan-2013.pdf | 2015-06-10 01:36 | 713K | |
| Maharashtra Agricultural Services Examination 2011.pdf | 2015-06-10 01:38 | 717K | |
| State Services Preliminery Examination-2010.pdf | 2015-06-10 01:47 | 719K | |
| Sales Tax Inspector Main Examination- 2012- Paper-I- [Marathi and English].pdf | 2015-06-10 01:46 | 722K | |
| State Services Preliminery Examination-2008.pdf | 2015-06-10 01:47 | 727K | |
| Sales-Tax-Inspector-Ltd-Dept2011-Paper-2.pdf | 2015-06-10 01:46 | 728K | |
| Maharashtra Engineering (Civil) Services Examination 2013- Paper 3.pdf | 2015-06-10 01:39 | 743K | |
| Assistant Motor Vehicle Inspector Main Examination- 2003 [Automobile Engineering].pdf | 2015-06-10 01:31 | 750K | |
| 20140405114935AM_Maharashtra Engineering [Mechanical] Services, Gr-B-Paper-1[Mar_Eng_GS].pdf | 2015-06-10 01:26 | 754K | |
| Assistant Motor Vehicle Inspector Main Examination- 2002.pdf | 2015-06-10 01:31 | 757K | |
| 20140702050228PM_Statistical Officer and Equivalent Post and Others Gr-A and Gr-B.pdf | 2015-06-10 01:28 | 762K | |
| State Services Preliminery Examination- 2007.pdf | 2015-06-10 01:47 | 762K | |
| 001_002.pdf | 2015-06-10 01:21 | 767K | |
| 2010 Syllabus.pdf | 2015-06-10 01:21 | 768K | |
| Assistant Motor Vehicle Inspector Main Examination- 2005 [GA].pdf | 2015-06-10 01:31 | 769K | |
| Assistant Motor Vehicle Inspector Main Examination- 2003 [Mechanical Engineering].pdf | 2015-06-10 01:31 | 780K | |
| Maharashtra Accounts and Finance, Class-III Dept Exam-Feb-2013.pdf | 2015-06-10 01:37 | 789K | |
| State Services Preliminery Examination-2011.pdf | 2015-06-10 01:47 | 792K | |
| Ground Water Survey and Development Exam-Nov-2006.pdf | 2015-06-10 01:36 | 794K | |
| 20140405115013AM_Maharashtra Engineering [Mechanical] Services, Gr-B-Paper-2 [Mechanical Engi].pdf | 2015-06-10 01:27 | 797K | |
| Sales Tax Officer Dept Exam- Aug- 2013.pdf | 2015-06-10 01:46 | 803K | |
| Assistant Commissioner (Word Officer) BMC - 2011.pdf | 2015-06-10 01:30 | 804K | |
| Assistant Motor Vehicle Inspector Main Examination- 2005.pdf | 2015-06-10 01:31 | 805K | |
| Sales Tax Inspector Limited Departmental Examination- 2012- Paper-1.pdf | 2015-06-10 01:45 | 822K | |
| Assistant Motor Vehicle Inspector Main Examination- 2005 [Mechanical Engineering].pdf | 2015-06-10 01:31 | 826K | |
| Assistant Motor Vehicle Inspector Main Examination- 2002 [Mechanical Engineering].pdf | 2015-06-10 01:31 | 826K | |
| Police_Sub_Inspector_Limited_Departmental_Main_Examination_2010_Peper-II-Law.pdf | 2015-06-10 01:44 | 826K | |
| Police_Superitendent_Assistant_Police_Commissioner_Screening_Test-2010.pdf | 2015-06-10 01:44 | 829K | |
| Police Sub Inspector Preliminary Examination 2011.pdf | 2015-06-10 01:44 | 834K | |
| Police_Sub_Inspector_Limited_Departmental_Main_Examination-2010_Peper-I.pdf | 2015-06-10 01:44 | 842K | |
| Maharashtra Accounts and Finance, Class-III Dept Exam-May-2011.pdf | 2015-06-10 01:37 | 845K | |
| Sales Tax Inspector Main Examination- 2011-[ Paper-2- GK and IQ TEST].pdf | 2015-06-10 01:45 | 852K | |
| GK_3.pdf | 2015-06-10 01:36 | 863K | |
| 335-2013 Deputy Engineer Electrical.Assistant Electrical Inspector PWD Gr-A Questions P.pdf | 2015-06-10 01:29 | 865K | |
| Employment and Self Employment Officer, Gr-B Screening Test-2012.pdf | 2015-06-10 01:35 | 871K | |
| 20140503043300PM_Maharashtra Finance and Account Services -Class 1- For Officers-December-2013.pdf | 2015-06-10 01:27 | 873K | |
| 20140416113702PM_LDO_2014(1).pdf | 2015-06-10 01:27 | 889K | |
| 20140416113702PM_LDO_2014.pdf | 2015-06-10 01:27 | 889K | |
| Administrative Officer Maha.Agri.Admn. Services Gr-A [Advt.No.300-2012] Question Paper.pdf | 2015-06-10 01:29 | 911K | |
| GK_1.pdf | 2015-06-10 01:36 | 917K | |
| 20131021042620PM_Police Sub Inspector Limited Departmental Examination-2013- Paper-2- Law.pdf | 2015-06-10 01:21 | 927K | |
| Assistant Motor Vehicle Inspector Main Examination- 2003.pdf | 2015-06-10 01:31 | 941K | |
| House_Master_Gr-B.pdf | 2015-06-10 01:36 | 950K | |
| Civil Judge (Junior Division) Judicial Magistrate (First Class) Preliminary Examination - 2011.pdf | 2015-06-10 01:33 | 952K | |
| GK_4.pdf | 2015-06-10 01:36 | 959K | |
| Sales Tax Inspector Limited Departmental Examination- 2012- Paper-2.pdf | 2015-06-10 01:45 | 968K | |
| 20131223021251PM_Sales Tax Inspector Priliminery Examination-2013.pdf | 2015-06-10 01:24 | 970K | |
| Assistant Limited Departmental Examination- 2011 (Paper- 2).pdf | 2015-06-10 01:31 | 972K | |
| Assistant Limited Departmental Examination- 2012-Paper 2.pdf | 2015-06-10 01:31 | 1.0M | |
| MPSCRTI.pdf | 2015-06-10 01:43 | 1.0M | |
| PSI Limited Dept Main Exam 2009- MARATHI, ENGLISH & GS.pdf | 2015-06-10 01:45 | 1.0M | |
| 20140503043403PM_Maharashtra Finance and Account Service, Class-III Deaprtmental Examination- April-2007.pdf | 2015-06-10 01:27 | 1.0M | |
| 20140503043522PM_Maharashtra Finance and Account Service, Class-III Deaprtmental Examination-November-2008(1).pdf | 2015-06-10 01:27 | 1.0M | |
| 20140503043522PM_Maharashtra Finance and Account Service, Class-III Deaprtmental Examination-November-2008.pdf | 2015-06-10 01:28 | 1.0M | |
| 20140225112351AM_Assistant Limited Departmental Examination-2013- Paper-2.pdf | 2015-06-10 01:25 | 1.0M | |
| 20140506034709PM_Maharashtra Engineering [Electrical- Mechanical] Services, Gr-B-Paper-2 [Electrical and Mechanical Engineering].pdf | 2015-06-10 01:28 | 1.0M | |
| Assistant Commissioner (Ward Officer) Screening Test - 2008- Paper1.pdf | 2015-06-10 01:30 | 1.0M | |
| GK_2.pdf | 2015-06-10 01:36 | 1.0M | |
| 20140503043448PM_Maharashtra Finance and Account Service, Class-III Deaprtmental Examination-June-2009.pdf | 2015-06-10 01:27 | 1.0M | |
| 20140607072531PM_Sales Tax Inspector Main Examination-2014- Paper-2- G.K. and I.T..pdf | 2015-06-10 01:28 | 1.1M | |
| Deputy_Director_of_Industries_(Technical),_Gr-A_&_Industries_Officer_(Technical),_Gr-B_in_Maharashtra_Industries_Service.pdf | 2015-06-10 01:34 | 1.1M | |
| 20140621074706PM_Assistant Preliminary Examination-2014.pdf | 2015-06-10 01:28 | 1.1M | |
| State Services Priliminery Examination- 2011.pdf | 2015-06-10 01:47 | 1.1M | |
| Assistant Public Prosecutor,Gr-A Screening Test-2012- Paper-2.pdf | 2015-06-10 01:32 | 1.1M | |
| Maharashtra Agriculural Services Main Examination- 2012-Agriculture Engineering.pdf | 2015-06-10 01:38 | 1.1M | |
| 20131217101727AM_Police Sub Inspector Main Exam-2013- Paper-2- G.K. and I.T.pdf | 2015-06-10 01:24 | 1.1M | |
| 20140526044030PM_Police Sub Inspector Preliminery Examination-2014.pdf | 2015-06-10 01:28 | 1.1M | |
| STATE_PRE_2013_PAPER_1.pdf | 2015-06-10 01:47 | 1.1M | |
| General Knowledge & Intelligent Test- Paper-II.pdf | 2015-06-10 01:35 | 1.1M | |
| Government_Labour_Officer_Screening_Test - 2009.pdf | 2015-06-10 01:36 | 1.1M | |
| Sales Tax Inspector Main Examination- 2012- Paper-II- [G.K. and I.T.].pdf | 2015-06-10 01:46 | 1.2M | |
| 20140128021346PM_Maharashtra Engineering [Civil] Services Main Examination-2013-Marathi_English and GS.pdf | 2015-06-10 01:25 | 1.2M | |
| PSI Limited Dept Main Exam 2009- LAW.pdf | 2015-06-10 01:45 | 1.2M | |
| 20140204022341PM_State Services Preliminary Examination-2014 - Paper-1.pdf | 2015-06-10 01:25 | 1.2M | |
| Police Sub Inspector Limited Dapartmental Main Examiantion- 2011 [Paper-2].pdf | 2015-06-10 01:43 | 1.2M | |
| 20140428053839PM_Assistant Commissioner [Drugs], HOD, Professor, Associate Profesor and Assistant Professor-Pharmacy Online Examination-2014.pdf | 2015-06-10 01:27 | 1.2M | |
| Police Sub Inspector Main Examination- 2012.[Paper-1].pdf | 2015-06-10 01:44 | 1.2M | |
| 20140220052302PM_Assistant Main Examination-2013-Paper-2.pdf | 2015-06-10 01:25 | 1.3M | |
| 20131107124555PM_Police Sub Inspector Limited Departmental Examination-2013- Paper-1- Marathi, English and General Studies.pdf | 2015-06-10 01:23 | 1.3M | |
| Technical Assistant,G.S.S.Gr-C Directorate of Insurance.pdf | 2015-06-10 01:48 | 1.3M | |
| State Services Preliminery Examination- 2012.pdf | 2015-06-10 01:47 | 1.3M | |
| Maharashtra Engineering (Civil) Services Examination 2013 -Paper 1.pdf | 2015-06-10 01:39 | 1.3M | |
| Assistant Controller of Rationing, Gr-B Screening Test.pdf | 2015-06-10 01:30 | 1.3M | |
| 20140606054826PM_State Service Main Examination-2014 - General Studies - 1.pdf | 2015-06-10 01:28 | 1.4M | |
| Maharashtra Agricultural Services preliminery Examination-2012.pdf | 2015-06-10 01:38 | 1.4M | |
| 20140606054909PM_State Service Main Examination-2014 - General Studies - 4.pdf | 2015-06-10 01:28 | 1.5M | |
| STATE_PRE_2013_PAPER_2.pdf | 2015-06-10 01:48 | 1.6M | |
| Assistant Public Prosecutor,Gr-A Screening Test-2012- Paper-1.pdf | 2015-06-10 01:32 | 1.6M | |
| Assistant Controller of Rationing, Group-B.pdf | 2015-06-10 01:30 | 1.6M | |
| Police Sub Inspector Limited Dapartmental Main Examiantion- 2011 [ Paper-1].pdf | 2015-06-10 01:43 | 1.7M | |
| Police Sub Inspector Preliminery Examination- 2013.pdf | 2015-06-10 01:44 | 1.7M | |
| 20140204022157PM_State Services Preliminary Examination-2014 - Paper-2.pdf | 2015-06-10 01:25 | 1.8M | |
| 20140606054837PM_State Service Main Examination-2014 - General Studies - 2.pdf | 2015-06-10 01:28 | 1.9M | |
| Superintendent Clerical Grade Gr-B Screening Test 2013.pdf | 2015-06-10 01:48 | 2.1M | |
| 20131030033857PM_State Services Main Examination-2013- GS-1.pdf | 2015-06-10 01:22 | 2.2M | |
| 20131030023030PM_State Services Main Examination-2013- GS-4.pdf | 2015-06-10 01:22 | 2.3M | |
| Police Sub Inspector Main Examination- 2012.[Paper-2].pdf | 2015-06-10 01:44 | 2.3M | |
| 20131030031703PM_State Services Main Examination-2013- GS-3.pdf | 2015-06-10 01:22 | 2.4M | |
| 20140314103304AM_Junior Geologist, Gr-B Online Examination-2014 [Advt.No. 57-2013].pdf | 2015-06-10 01:26 | 2.6M | |
| 20130927013009PM_Metron, Grade-III, Gr-B Screening Test-2013.pdf | 2015-06-10 01:22 | 2.9M | |
| 20140314103117AM_Deputy Engineer Mechanical, Gr-A Online Examination-2014 [Advt.No. 58-2013].pdf | 2015-06-10 01:26 | 2.9M | |
| 20131030033540PM_State Services Main Examination-2013- GS-2.pdf | 2015-06-10 01:23 | 3.0M | |
| 20140404024655PM_Deputy Director Industries Gr A Screening Test 2013 QP.pdf | 2015-06-10 01:26 | 4.5M | |
| Maharashtra Engineering [Civil] Services Main Examination- 2012- Civil Engineering- PAPER_1.pdf | 2015-06-10 01:40 | 4.7M | |
| Maharashtra Engineering [Civil] Services Main Examination- 2012- Civil Engineering- PAPER_2.pdf | 2015-06-10 01:41 | 4.7M | |
| 20131209051558PM_Assistant-Deputy Charity Commissioner Screening Test-2013.pdf | 2015-06-10 01:24 | 6.3M | |
| 20131209051527PM_Joint Charity Commissioner Screening Test-2013.pdf | 2015-06-10 01:24 | 6.4M | |
| Clerk-Typist-Examination-2007-QP.pdf | 2015-06-10 01:34 | 6.8M | |
| Maharashtra Engineering [Civil] Services Main Examination- 2012- Marathi, English and General Studies.pdf | 2015-06-10 01:41 | 9.1M | |
|
|---|